Compound Q&A

What are the main uses of 2,4-Difluoro-3-hydroxybenzoic acid (CAS: 91659-08-4)?

Answer

2,4-Difluoro-3-hydroxybenzoic acid
2,4-Difluoro-3-hydroxybenzoic acid is primarily used in the synthesis of pharmaceuticals and agrochemicals. It also finds applications in the production of intermediates for the pharmaceutical industry and in research for developing new drugs. Additionally, it is used in the synthesis of certain dyes and pigments.

About

CAS No 91659-08-4
English Name 2,4-Difluoro-3-hydroxybenzoic acid
Molecular Formula C7H4F2O3
Molecular Weight 174.1 g/mol
SMILES C1=CC(=C(C(=C1C(=O)O)F)O)F
InChIKey AYDXPNZXVSSJRD-UHFFFAOYSA-N
Last Updated: 2026-01-06 22:14

Related Q&A

Compound Q&A

What is 2,4-Difluoro-3-hydroxybenzoic acid (CAS: 91659-08-4)?

2,4-Difluoro-3-hydroxybenzoic acid is an organic compound with the molecular formula C7H4O4F2. It is...

Compound Q&A

Is 2,4-Difluoro-3-hydroxybenzoic acid (CAS: 91659-08-4) safe?

2,4-Difluoro-3-hydroxybenzoic acid is generally safe when handled with appropriate precautions. Howe...

Compound Q&A

How should 2,4-Difluoro-3-hydroxybenzoic acid (CAS: 91659-08-4) be stored?

2,4-Difluoro-3-hydroxybenzoic acid should be stored in a cool, dry place away from direct sunlight a...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...