Compound Q&A

What are the main uses of 2-[2-(tert-butoxycarbonylamino)thiazol-4-yl]-2-oxo-acetic acid (CAS: 73181-56-3)?

Answer

2-[2-(tert-butoxycarbonylamino)thiazol-4-yl]-2-oxo-acetic acid
2-[2-(tert-butoxycarbonylamino)thiazol-4-yl]-2-oxo-acetic acid (CAS: 73181-56-3) is primarily used in pharmaceuticals for the synthesis of other compounds, and in research as a building block for various organic reactions and drug development.

About

CAS No 73181-56-3
English Name 2-[2-(tert-butoxycarbonylamino)thiazol-4-yl]-2-oxo-acetic acid
Molecular Formula C10H12N2O5S
Molecular Weight 272.28 g/mol
SMILES CC(C)(C)OC(=O)Nc1nc(cs1)C(=O)C(=O)O
InChIKey LDTMNHIZDFDFFY-UHFFFAOYSA-N
Last Updated: 2026-01-06 22:14

Related Q&A

Compound Q&A

What is 2-[2-(tert-butoxycarbonylamino)thiazol-4-yl]-2-oxo-acetic acid (CAS: 73181-56-3)?

2-[2-(tert-butoxycarbonylamino)thiazol-4-yl]-2-oxo-acetic acid (CAS: 73181-56-3) is a chemical compo...

Compound Q&A

Is 2-[2-(tert-butoxycarbonylamino)thiazol-4-yl]-2-oxo-acetic acid (CAS: 73181-56-3) safe?

2-[2-(tert-butoxycarbonylamino)thiazol-4-yl]-2-oxo-acetic acid (CAS: 73181-56-3) is generally safe w...

Compound Q&A

How should 2-[2-(tert-butoxycarbonylamino)thiazol-4-yl]-2-oxo-acetic acid (CAS: 73181-56-3) be stored?

2-[2-(tert-butoxycarbonylamino)thiazol-4-yl]-2-oxo-acetic acid (CAS: 73181-56-3) should be stored in...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...