Compound Q&A

What is 2-[2-(tert-butoxycarbonylamino)thiazol-4-yl]-2-oxo-acetic acid (CAS: 73181-56-3)?

Answer

2-[2-(tert-butoxycarbonylamino)thiazol-4-yl]-2-oxo-acetic acid
2-[2-(tert-butoxycarbonylamino)thiazol-4-yl]-2-oxo-acetic acid (CAS: 73181-56-3) is a chemical compound with a molecular formula of C12H17NO5S. It is characterized by its thiazole and carbonyl groups, and it is often used in pharmaceutical and research applications due to its functional groups.

About

CAS No 73181-56-3
English Name 2-[2-(tert-butoxycarbonylamino)thiazol-4-yl]-2-oxo-acetic acid
Molecular Formula C10H12N2O5S
Molecular Weight 272.28 g/mol
SMILES CC(C)(C)OC(=O)Nc1nc(cs1)C(=O)C(=O)O
InChIKey LDTMNHIZDFDFFY-UHFFFAOYSA-N
Last Updated: 2026-01-06 22:14

Related Q&A

Compound Q&A

What are the main uses of 2-[2-(tert-butoxycarbonylamino)thiazol-4-yl]-2-oxo-acetic acid (CAS: 73181-56-3)?

2-[2-(tert-butoxycarbonylamino)thiazol-4-yl]-2-oxo-acetic acid (CAS: 73181-56-3) is primarily used i...

Compound Q&A

Is 2-[2-(tert-butoxycarbonylamino)thiazol-4-yl]-2-oxo-acetic acid (CAS: 73181-56-3) safe?

2-[2-(tert-butoxycarbonylamino)thiazol-4-yl]-2-oxo-acetic acid (CAS: 73181-56-3) is generally safe w...

Compound Q&A

How should 2-[2-(tert-butoxycarbonylamino)thiazol-4-yl]-2-oxo-acetic acid (CAS: 73181-56-3) be stored?

2-[2-(tert-butoxycarbonylamino)thiazol-4-yl]-2-oxo-acetic acid (CAS: 73181-56-3) should be stored in...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...