Compound Q&A

What industries use N-[3-[Tris(trimethylsiloxy)silyl]propyl]acrylamide (CAS: 115258-10-1)?

Answer

N-[3-[Tris(trimethylsiloxy)silyl]propyl]acrylamide
N-[3-[Tris(trimethylsiloxy)silyl]propyl]acrylamide (CAS: 115258-10-1) is used in the pharmaceutical industry for the synthesis of organosilicon polymers, in the polymer industry for preparing coatings and adhesives, and in the semiconductor industry for producing specialized sensors and materials.

About

English Name N-[3-[Tris(trimethylsiloxy)silyl]propyl]acrylamide
Molecular Formula C15H37NO4Si4
Molecular Weight 407.81 g/mol
SMILES C[Si](C)(C)O[Si](CCCNC(=O)C=C)(O[Si](C)(C)C)O[Si](C)(C)C
InChIKey VJUBAEVLVNBCON-UHFFFAOYSA-N
Last Updated: 2026-01-04 19:14

Related Q&A

Compound Q&A

What are the physical and chemical properties of N-[3-[Tris(trimethylsiloxy)silyl]propyl]acrylamide (CAS: 115258-10-1)?

N-[3-[Tris(trimethylsiloxy)silyl]propyl]acrylamide (CAS: 115258-10-1) is a colorless or white solid ...

Compound Q&A

How is N-[3-[Tris(trimethylsiloxy)silyl]propyl]acrylamide (CAS: 115258-10-1) typically synthesized?

N-[3-[Tris(trimethylsiloxy)silyl]propyl]acrylamide (CAS: 115258-10-1) is synthesized through a multi...

Compound Q&A

What precautions should be taken when handling N-[3-[Tris(trimethylsiloxy)silyl]propyl]acrylamide (CAS: 115258-10-1)?

When handling N-[3-[Tris(trimethylsiloxy)silyl]propyl]acrylamide (CAS: 115258-10-1), ensure proper v...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...