Compound Q&A

How is N-[3-[Tris(trimethylsiloxy)silyl]propyl]acrylamide (CAS: 115258-10-1) typically synthesized?

Answer

N-[3-[Tris(trimethylsiloxy)silyl]propyl]acrylamide
N-[3-[Tris(trimethylsiloxy)silyl]propyl]acrylamide (CAS: 115258-10-1) is synthesized through a multi-step process involving reaction of acryloyl chloride with 3-(trimethylsiloxy)propyltrimethylsilane. Common solvents include toluene or dichloromethane. The reaction typically requires a mild base and a catalyst to enhance selectivity and yield.

About

English Name N-[3-[Tris(trimethylsiloxy)silyl]propyl]acrylamide
Molecular Formula C15H37NO4Si4
Molecular Weight 407.81 g/mol
SMILES C[Si](C)(C)O[Si](CCCNC(=O)C=C)(O[Si](C)(C)C)O[Si](C)(C)C
InChIKey VJUBAEVLVNBCON-UHFFFAOYSA-N
Last Updated: 2026-01-04 19:14

Related Q&A

Compound Q&A

What are the physical and chemical properties of N-[3-[Tris(trimethylsiloxy)silyl]propyl]acrylamide (CAS: 115258-10-1)?

N-[3-[Tris(trimethylsiloxy)silyl]propyl]acrylamide (CAS: 115258-10-1) is a colorless or white solid ...

Compound Q&A

What industries use N-[3-[Tris(trimethylsiloxy)silyl]propyl]acrylamide (CAS: 115258-10-1)?

N-[3-[Tris(trimethylsiloxy)silyl]propyl]acrylamide (CAS: 115258-10-1) is used in the pharmaceutical ...

Compound Q&A

What precautions should be taken when handling N-[3-[Tris(trimethylsiloxy)silyl]propyl]acrylamide (CAS: 115258-10-1)?

When handling N-[3-[Tris(trimethylsiloxy)silyl]propyl]acrylamide (CAS: 115258-10-1), ensure proper v...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...