Compound Q&A

What industries use 5,7-Dichloroisoquinoline (CAS: 73075-58-8)?

Answer

5,7-Dichloroisoquinoline
5,7-Dichloroisoquinoline is used in the pharmaceutical industry as a precursor for synthesizing bioactive compounds. It also finds applications in the polymer industry for developing certain types of plastics and resins. Additionally, it is used in the sensor industry for its ability to detect specific chemical species, and in the semiconductor industry for its use in organic light-emitting diodes (OLEDs).

About

CAS No 73075-58-8
English Name 5,7-Dichloroisoquinoline
Molecular Formula C9H5Cl2N
Molecular Weight 198.05 g/mol
SMILES C1=CN=CC2=C1C(=CC(=C2)Cl)Cl
InChIKey LRTAHCUSBZEOBO-UHFFFAOYSA-N
Last Updated: 2026-01-04 19:14

Related Q&A

Compound Q&A

What are the physical and chemical properties of 5,7-Dichloroisoquinoline (CAS: 73075-58-8)?

5,7-Dichloroisoquinoline is a crystalline compound with a molecular weight of approximately 229.01 g...

Compound Q&A

How is 5,7-Dichloroisoquinoline (CAS: 73075-58-8) typically synthesized?

5,7-Dichloroisoquinoline is typically synthesized via condensation reactions, such as the Claisen co...

Compound Q&A

What precautions should be taken when handling 5,7-Dichloroisoquinoline (CAS: 73075-58-8)?

When handling 5,7-Dichloroisoquinoline, appropriate personal protective equipment (PPE) should be wo...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...