Compound Q&A

What are the physical and chemical properties of 5,7-Dichloroisoquinoline (CAS: 73075-58-8)?

Answer

5,7-Dichloroisoquinoline
5,7-Dichloroisoquinoline is a crystalline compound with a molecular weight of approximately 229.01 g/mol. It has a low solubility in water but is more soluble in organic solvents such as ethanol and acetone. Chemically, it is less reactive compared to some other aromatic compounds, making it suitable for various synthetic applications. Its stability and reactivity make it useful in organic synthesis and as a precursor in the development of drug candidates.

About

CAS No 73075-58-8
English Name 5,7-Dichloroisoquinoline
Molecular Formula C9H5Cl2N
Molecular Weight 198.05 g/mol
SMILES C1=CN=CC2=C1C(=CC(=C2)Cl)Cl
InChIKey LRTAHCUSBZEOBO-UHFFFAOYSA-N
Last Updated: 2026-01-04 19:14

Related Q&A

Compound Q&A

How is 5,7-Dichloroisoquinoline (CAS: 73075-58-8) typically synthesized?

5,7-Dichloroisoquinoline is typically synthesized via condensation reactions, such as the Claisen co...

Compound Q&A

What industries use 5,7-Dichloroisoquinoline (CAS: 73075-58-8)?

5,7-Dichloroisoquinoline is used in the pharmaceutical industry as a precursor for synthesizing bioa...

Compound Q&A

What precautions should be taken when handling 5,7-Dichloroisoquinoline (CAS: 73075-58-8)?

When handling 5,7-Dichloroisoquinoline, appropriate personal protective equipment (PPE) should be wo...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...