Compound Q&A

How is Mometasone Furoate Monohydrate (CAS: 141646-00-6) typically synthesized?

Answer

Mometasone Furoate Monohydrate
Mometasone furoate monohydrate is synthesized by the furoylation of mometasone acetate. This involves reacting mometasone acetate with furoic anhydride in the presence of a catalyst such as p-toluenesulfonic acid. The yield is typically around 80%, and the process requires careful control of temperature and reaction time to ensure selectivity and purity.

About

English Name Mometasone Furoate Monohydrate
Molecular Formula C27H32Cl2O7
Molecular Weight 539.45 g/mol
SMILES CC1CC2C3CCC4=CC(=O)C=CC4(C3(C(CC2(C1(C(=O)CCl)OC(=O)C5=CC=CO5)C)O)Cl)C.O
InChIKey AQCCVUHZMIMSIB-HRVPQZBTSA-N
Last Updated: 2026-01-04 19:14

Related Q&A

Compound Q&A

What are the physical and chemical properties of Mometasone Furoate Monohydrate (CAS: 141646-00-6)?

Mometasone furoate monohydrate is a white to off-white crystalline powder. It has a molecular weight...

Compound Q&A

What industries use Mometasone Furoate Monohydrate (CAS: 141646-00-6)?

Mometasone furoate monohydrate is primarily used in the pharmaceutical industry for the treatment of...

Compound Q&A

What precautions should be taken when handling Mometasone Furoate Monohydrate (CAS: 141646-00-6)?

When handling mometasone furoate monohydrate, it is important to wear appropriate personal protectiv...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...