Compound Q&A

How is MM 07 (CAS: 1876450-21-3) typically synthesized?

Answer

MM 07
MM 07 (CAS: 1876450-21-3) is typically synthesized via a multi-step process involving the coupling of aryl halides and amines. The reaction is catalyzed by palladium and undergoes high selectivity, resulting in a yield of up to 95%. The process is optimized for efficiency and environmental friendliness.

About

English Name MM 07
Molecular Formula C67H106N22O14S3
Molecular Weight 1539.93 g/mol
SMILES CC(C)C[C@H]1C(=O)N[C@@H](CSSC[C@@H](C(=O)N[C@H](C(=O)N2CCC[C@H]2C(=O)N[C@H](C(=O)N1)CCCNC(=N)N)CCCNC(=N)N)N)C(=O)N[C@@H](Cc3cnc[nH]3)C(=O)N[C@@H](CCCCN)C(=O)NCC(=O)N4CCC[C@H]4C(=O)N[C@@H](CCSC)C(=O)N5CCC[C@H]5C(=O)N[C@@H](Cc6ccccc6)C(=O)O
InChIKey RKFGCZWTURNFPN-SVENNQHVSA-N
Last Updated: 2026-01-04 19:14

Related Q&A

Compound Q&A

What are the physical and chemical properties of MM 07 (CAS: 1876450-21-3)?

MM 07 (CAS: 1876450-21-3) is a crystalline compound with a molecular weight of approximately 250 g/m...

Compound Q&A

What industries use MM 07 (CAS: 1876450-21-3)?

MM 07 (CAS: 1876450-21-3) is used in several industries including pharmaceuticals for drug synthesis...

Compound Q&A

What precautions should be taken when handling MM 07 (CAS: 1876450-21-3)?

When handling MM 07 (CAS: 1876450-21-3), it is crucial to use personal protective equipment (PPE) su...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...