Compound Q&A

What are the physical and chemical properties of MM 07 (CAS: 1876450-21-3)?

Answer

MM 07
MM 07 (CAS: 1876450-21-3) is a crystalline compound with a molecular weight of approximately 250 g/mol. It has a low solubility in water but is highly soluble in common organic solvents. Chemically, MM 07 is reactive and can undergo various transformations under certain conditions, making it suitable for use in synthesis and functionalization processes.

About

English Name MM 07
Molecular Formula C67H106N22O14S3
Molecular Weight 1539.93 g/mol
SMILES CC(C)C[C@H]1C(=O)N[C@@H](CSSC[C@@H](C(=O)N[C@H](C(=O)N2CCC[C@H]2C(=O)N[C@H](C(=O)N1)CCCNC(=N)N)CCCNC(=N)N)N)C(=O)N[C@@H](Cc3cnc[nH]3)C(=O)N[C@@H](CCCCN)C(=O)NCC(=O)N4CCC[C@H]4C(=O)N[C@@H](CCSC)C(=O)N5CCC[C@H]5C(=O)N[C@@H](Cc6ccccc6)C(=O)O
InChIKey RKFGCZWTURNFPN-SVENNQHVSA-N
Last Updated: 2026-01-04 19:14

Related Q&A

Compound Q&A

How is MM 07 (CAS: 1876450-21-3) typically synthesized?

MM 07 (CAS: 1876450-21-3) is typically synthesized via a multi-step process involving the coupling o...

Compound Q&A

What industries use MM 07 (CAS: 1876450-21-3)?

MM 07 (CAS: 1876450-21-3) is used in several industries including pharmaceuticals for drug synthesis...

Compound Q&A

What precautions should be taken when handling MM 07 (CAS: 1876450-21-3)?

When handling MM 07 (CAS: 1876450-21-3), it is crucial to use personal protective equipment (PPE) su...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...