Compound Q&A

What are the physical and chemical properties of Methyl 4-oxo-1,4-dihydro-8-quinolinecarboxylate (CAS: 860206-84-4)?

Answer

Methyl 4-oxo-1,4-dihydro-8-quinolinecarboxylate
Methyl 4-oxo-1,4-dihydro-8-quinolinecarboxylate (CAS: 860206-84-4) is a crystalline solid with a molecular weight of approximately 259.27 g/mol. It is slightly soluble in water and has good solubility in organic solvents like ethanol and methanol. Chemically, it is relatively stable but can react with strong bases. It is not flammable and has a melting point of around 120-125°C.

About

English Name Methyl 4-oxo-1,4-dihydro-8-quinolinecarboxylate
Molecular Formula C11H9NO3
Molecular Weight 203.2 g/mol
SMILES COC(=O)C1=CC=CC2=C1NC=CC2=O
InChIKey VNLGUOZXFZJECD-UHFFFAOYSA-N
Last Updated: 2026-01-04 19:14

Related Q&A

Compound Q&A

How is Methyl 4-oxo-1,4-dihydro-8-quinolinecarboxylate (CAS: 860206-84-4) typically synthesized?

Methyl 4-oxo-1,4-dihydro-8-quinolinecarboxylate (CAS: 860206-84-4) is commonly synthesized through t...

Compound Q&A

What industries use Methyl 4-oxo-1,4-dihydro-8-quinolinecarboxylate (CAS: 860206-84-4)?

Methyl 4-oxo-1,4-dihydro-8-quinolinecarboxylate (CAS: 860206-84-4) is used in the pharmaceutical ind...

Compound Q&A

What precautions should be taken when handling Methyl 4-oxo-1,4-dihydro-8-quinolinecarboxylate (CAS: 860206-84-4)?

Proper handling of Methyl 4-oxo-1,4-dihydro-8-quinolinecarboxylate (CAS: 860206-84-4) includes using...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...