Compound Q&A

What industries use 1-[1-(3-Methoxyphenyl)-7-Propoxy-3-Indolizinyl]Ethanone (CAS: 1693766-04-9)?

Answer

1-[1-(3-Methoxyphenyl)-7-propoxy-3-indolizinyl]ethanone
1-[1-(3-Methoxyphenyl)-7-Propoxy-3-Indolizinyl]Ethanone (CAS: 1693766-04-9) is used in the pharmaceutical industry for the development of new drugs due to its potential medicinal properties. It may also find applications in the polymer industry for the synthesis of novel polymers and in the sensor and semiconductor industries for specific functional materials.

About

English Name 1-[1-(3-Methoxyphenyl)-7-propoxy-3-indolizinyl]ethanone
Molecular Formula C20H21NO3
Molecular Weight 323.39 g/mol
SMILES CCCOc1ccn2c(c1)c(cc2C(=O)C)c3cccc(c3)OC
InChIKey QQBGNWWJANJWNY-UHFFFAOYSA-N
Last Updated: 2026-01-04 19:14

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1-[1-(3-Methoxyphenyl)-7-propoxy-3-indolizinyl]ethanone (CAS: 1693766-04-9)?

1-[1-(3-Methoxyphenyl)-7-Propoxy-3-Indolizinyl]Ethanone (CAS: 1693766-04-9) is a crystalline compoun...

Compound Q&A

How is 1-[1-(3-Methoxyphenyl)-7-Propoxy-3-Indolizinyl]Ethanone (CAS: 1693766-04-9) typically synthesized?

1-[1-(3-Methoxyphenyl)-7-Propoxy-3-Indolizinyl]Ethanone (CAS: 1693766-04-9) can be synthesized throu...

Compound Q&A

What precautions should be taken when handling 1-[1-(3-Methoxyphenyl)-7-Propoxy-3-Indolizinyl]Ethanone (CAS: 1693766-04-9)?

When handling 1-[1-(3-Methoxyphenyl)-7-Propoxy-3-Indolizinyl]Ethanone (CAS: 1693766-04-9), it is cru...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...