Compound Q&A

How is 1-[1-(3-Methoxyphenyl)-7-Propoxy-3-Indolizinyl]Ethanone (CAS: 1693766-04-9) typically synthesized?

Answer

1-[1-(3-Methoxyphenyl)-7-propoxy-3-indolizinyl]ethanone
1-[1-(3-Methoxyphenyl)-7-Propoxy-3-Indolizinyl]Ethanone (CAS: 1693766-04-9) can be synthesized through a multi-step process involving the condensation reaction of 3-methoxyphenyl with propoxyindolizine, followed by the ethylation of the resultant product. The synthesis typically involves the use of a catalyst and requires specific conditions for optimal yield and selectivity.

About

English Name 1-[1-(3-Methoxyphenyl)-7-propoxy-3-indolizinyl]ethanone
Molecular Formula C20H21NO3
Molecular Weight 323.39 g/mol
SMILES CCCOc1ccn2c(c1)c(cc2C(=O)C)c3cccc(c3)OC
InChIKey QQBGNWWJANJWNY-UHFFFAOYSA-N
Last Updated: 2026-01-04 19:14

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1-[1-(3-Methoxyphenyl)-7-propoxy-3-indolizinyl]ethanone (CAS: 1693766-04-9)?

1-[1-(3-Methoxyphenyl)-7-Propoxy-3-Indolizinyl]Ethanone (CAS: 1693766-04-9) is a crystalline compoun...

Compound Q&A

What industries use 1-[1-(3-Methoxyphenyl)-7-Propoxy-3-Indolizinyl]Ethanone (CAS: 1693766-04-9)?

1-[1-(3-Methoxyphenyl)-7-Propoxy-3-Indolizinyl]Ethanone (CAS: 1693766-04-9) is used in the pharmaceu...

Compound Q&A

What precautions should be taken when handling 1-[1-(3-Methoxyphenyl)-7-Propoxy-3-Indolizinyl]Ethanone (CAS: 1693766-04-9)?

When handling 1-[1-(3-Methoxyphenyl)-7-Propoxy-3-Indolizinyl]Ethanone (CAS: 1693766-04-9), it is cru...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...