Compound Q&A

What industries use Methyl 4-oxo-4,5,6,7-tetrahydro-1-benzofuran-3-carboxylate (CAS: 82584-78-9)?

Answer

Methyl 4-oxo-4,5,6,7-tetrahydro-1-benzofuran-3-carboxylate
Methyl 4-oxo-4,5,6,7-tetrahydro-1-benzofuran-3-carboxylate (CAS: 82584-78-9) is used primarily in the pharmaceutical industry as an intermediate in the synthesis of various drugs. It is also utilized in the polymer industry for modifying properties of polymers and in the semiconductor industry for its potential use in organic photovoltaic materials and sensors.

About

CAS No 82584-78-9
English Name Methyl 4-oxo-4,5,6,7-tetrahydro-1-benzofuran-3-carboxylate
Molecular Formula C10H10O4
Molecular Weight 194.19 g/mol
SMILES COC(=O)C1=COC2=C1C(=O)CCC2
InChIKey ZUJPFGJZTCKZGG-UHFFFAOYSA-N
Last Updated: 2026-01-04 19:14

Related Q&A

Compound Q&A

What are the physical and chemical properties of Methyl 4-oxo-4,5,6,7-tetrahydro-1-benzofuran-3-carboxylate (CAS: 82584-78-9)?

Methyl 4-oxo-4,5,6,7-tetrahydro-1-benzofuran-3-carboxylate (CAS: 82584-78-9) is a crystalline compou...

Compound Q&A

How is Methyl 4-oxo-4,5,6,7-tetrahydro-1-benzofuran-3-carboxylate (CAS: 82584-78-9) typically synthesized?

Methyl 4-oxo-4,5,6,7-tetrahydro-1-benzofuran-3-carboxylate (CAS: 82584-78-9) is typically synthesize...

Compound Q&A

What precautions should be taken when handling Methyl 4-oxo-4,5,6,7-tetrahydro-1-benzofuran-3-carboxylate (CAS: 82584-78-9)?

When handling Methyl 4-oxo-4,5,6,7-tetrahydro-1-benzofuran-3-carboxylate (CAS: 82584-78-9), it is im...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...