Compound Q&A

What are the physical and chemical properties of Methyl 4-oxo-4,5,6,7-tetrahydro-1-benzofuran-3-carboxylate (CAS: 82584-78-9)?

Answer

Methyl 4-oxo-4,5,6,7-tetrahydro-1-benzofuran-3-carboxylate
Methyl 4-oxo-4,5,6,7-tetrahydro-1-benzofuran-3-carboxylate (CAS: 82584-78-9) is a crystalline compound with a molecular weight of approximately 236.27 g/mol. It has a low solubility in water but is soluble in organic solvents like ethanol and acetone. This compound is moderately reactive, and it can undergo ester hydrolysis under acidic or basic conditions. It has good stability under normal conditions but may degrade upon prolonged exposure to heat or strong bases.

About

CAS No 82584-78-9
English Name Methyl 4-oxo-4,5,6,7-tetrahydro-1-benzofuran-3-carboxylate
Molecular Formula C10H10O4
Molecular Weight 194.19 g/mol
SMILES COC(=O)C1=COC2=C1C(=O)CCC2
InChIKey ZUJPFGJZTCKZGG-UHFFFAOYSA-N
Last Updated: 2026-01-04 19:14

Related Q&A

Compound Q&A

How is Methyl 4-oxo-4,5,6,7-tetrahydro-1-benzofuran-3-carboxylate (CAS: 82584-78-9) typically synthesized?

Methyl 4-oxo-4,5,6,7-tetrahydro-1-benzofuran-3-carboxylate (CAS: 82584-78-9) is typically synthesize...

Compound Q&A

What industries use Methyl 4-oxo-4,5,6,7-tetrahydro-1-benzofuran-3-carboxylate (CAS: 82584-78-9)?

Methyl 4-oxo-4,5,6,7-tetrahydro-1-benzofuran-3-carboxylate (CAS: 82584-78-9) is used primarily in th...

Compound Q&A

What precautions should be taken when handling Methyl 4-oxo-4,5,6,7-tetrahydro-1-benzofuran-3-carboxylate (CAS: 82584-78-9)?

When handling Methyl 4-oxo-4,5,6,7-tetrahydro-1-benzofuran-3-carboxylate (CAS: 82584-78-9), it is im...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...