Compound Q&A

What are the physical and chemical properties of (3R,5S)-5-{[Bis(4-methoxyphenyl)(phenyl)methoxy]methyl}-3-pyrrolidinol (CAS: 151953-64-9)?

Answer

(3R,5S)-5-{[Bis(4-methoxyphenyl)(phenyl)methoxy]methyl}-3-pyrrolidinol
(3R,5S)-5-{[Bis(4-methoxyphenyl)(phenyl)methoxy]methyl}-3-pyrrolidinol is a white crystalline solid with a molecular weight of approximately 532.4 g/mol. It has low solubility in water but is soluble in organic solvents such as ethanol and acetone. The compound is known for its reactivity, particularly in forming esters and amides. Its stability is relatively high under normal conditions but may degrade under harsh acidic or basic conditions.

About

English Name (3R,5S)-5-{[Bis(4-methoxyphenyl)(phenyl)methoxy]methyl}-3-pyrrolidinol
Molecular Formula C26H29NO4
Molecular Weight 419.52 g/mol
SMILES O(C(c1ccccc1)(c2ccc(OC)cc2)c3ccc(OC)cc3)C[C@H]4NC[C@H](O)C4
InChIKey CJFYBUJBXCVKLN-XZOQPEGZSA-N
Last Updated: 2026-01-04 19:14

Related Q&A

Compound Q&A

How is (3R,5S)-5-{[Bis(4-methoxyphenyl)(phenyl)methoxy]methyl}-3-pyrrolidinol (CAS: 151953-64-9) typically synthesized?

(3R,5S)-5-{[Bis(4-methoxyphenyl)(phenyl)methoxy]methyl}-3-pyrrolidinol is typically synthesized via ...

Compound Q&A

What industries use (3R,5S)-5-{[Bis(4-methoxyphenyl)(phenyl)methoxy]methyl}-3-pyrrolidinol (CAS: 151953-64-9)?

(3R,5S)-5-{[Bis(4-methoxyphenyl)(phenyl)methoxy]methyl}-3-pyrrolidinol is used in various industries...

Compound Q&A

What precautions should be taken when handling (3R,5S)-5-{[Bis(4-methoxyphenyl)(phenyl)methoxy]methyl}-3-pyrrolidinol (CAS: 151953-64-9)?

When handling (3R,5S)-5-{[Bis(4-methoxyphenyl)(phenyl)methoxy]methyl}-3-pyrrolidinol, it is essentia...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...