Compound Q&A

What industries use Ethyl (5-bromo-2-methyl-1H-indol-3-yl)acetate (CAS: 72016-68-3)?

Answer

Ethyl (5-bromo-2-methyl-1H-indol-3-yl)acetate
Ethyl (5-bromo-2-methyl-1H-indol-3-yl)acetate is primarily used in the pharmaceutical industry for the synthesis of certain bioactive compounds. It also finds applications in organic synthesis as an acylating agent. Additionally, it can be used in the development of sensors and as a precursor in the synthesis of various organic molecules with potential use in semiconductors.

About

CAS No 72016-68-3
English Name Ethyl (5-bromo-2-methyl-1H-indol-3-yl)acetate
Molecular Formula C13H14BrNO2
Molecular Weight 296.16 g/mol
SMILES CCOC(=O)CC1=C(NC2=C1C=C(C=C2)Br)C
InChIKey GNAIWTYKMSIQQR-UHFFFAOYSA-N
Last Updated: 2026-01-04 19:14

Related Q&A

Compound Q&A

What are the physical and chemical properties of Ethyl (5-bromo-2-methyl-1H-indol-3-yl)acetate (CAS: 72016-68-3)?

Ethyl (5-bromo-2-methyl-1H-indol-3-yl)acetate is a crystalline compound, with a molecular weight of ...

Compound Q&A

How is Ethyl (5-bromo-2-methyl-1H-indol-3-yl)acetate (CAS: 72016-68-3) typically synthesized?

Ethyl (5-bromo-2-methyl-1H-indol-3-yl)acetate is synthesized through a condensation reaction between...

Compound Q&A

What precautions should be taken when handling Ethyl (5-bromo-2-methyl-1H-indol-3-yl)acetate (CAS: 72016-68-3)?

When handling Ethyl (5-bromo-2-methyl-1H-indol-3-yl)acetate, it is essential to wear appropriate per...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...