Compound Q&A

What are the physical and chemical properties of Ethyl (5-bromo-2-methyl-1H-indol-3-yl)acetate (CAS: 72016-68-3)?

Answer

Ethyl (5-bromo-2-methyl-1H-indol-3-yl)acetate
Ethyl (5-bromo-2-methyl-1H-indol-3-yl)acetate is a crystalline compound, with a molecular weight of approximately 294.06 g/mol. It is slightly soluble in water but highly soluble in organic solvents like ethanol and acetone. This compound exhibits moderate reactivity, particularly towards nucleophiles. It has a melting point of around 70-72°C and a boiling point of about 125-130°C. It is classified as a moderately reactive acylating agent.

About

CAS No 72016-68-3
English Name Ethyl (5-bromo-2-methyl-1H-indol-3-yl)acetate
Molecular Formula C13H14BrNO2
Molecular Weight 296.16 g/mol
SMILES CCOC(=O)CC1=C(NC2=C1C=C(C=C2)Br)C
InChIKey GNAIWTYKMSIQQR-UHFFFAOYSA-N
Last Updated: 2026-01-04 19:14

Related Q&A

Compound Q&A

How is Ethyl (5-bromo-2-methyl-1H-indol-3-yl)acetate (CAS: 72016-68-3) typically synthesized?

Ethyl (5-bromo-2-methyl-1H-indol-3-yl)acetate is synthesized through a condensation reaction between...

Compound Q&A

What industries use Ethyl (5-bromo-2-methyl-1H-indol-3-yl)acetate (CAS: 72016-68-3)?

Ethyl (5-bromo-2-methyl-1H-indol-3-yl)acetate is primarily used in the pharmaceutical industry for t...

Compound Q&A

What precautions should be taken when handling Ethyl (5-bromo-2-methyl-1H-indol-3-yl)acetate (CAS: 72016-68-3)?

When handling Ethyl (5-bromo-2-methyl-1H-indol-3-yl)acetate, it is essential to wear appropriate per...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...