Compound Q&A

What are the physical and chemical properties of 2-Bromo-1H-indene-1,3(2H)-dione (CAS: 7319-63-3)?

Answer

2-Bromo-1H-indene-1,3(2H)-dione
2-Bromo-1H-indene-1,3(2H)-dione (CAS: 7319-63-3) is a crystalline solid with a molecular weight of approximately 226.03 g/mol. It has a melting point of around 125-127°C and is poorly soluble in water but soluble in organic solvents like ethanol and acetone. Chemically, it is relatively stable but can react with strong nucleophiles under certain conditions. It is a key intermediate in the synthesis of various pharmaceuticals and polymers.

About

CAS No 7319-63-3
English Name 2-Bromo-1H-indene-1,3(2H)-dione
Molecular Formula C9H5BrO2
Molecular Weight 225.04 g/mol
SMILES C1=CC=C2C(=C1)C(=O)C(C2=O)Br
InChIKey DJSJIJDUPBUBKX-UHFFFAOYSA-N
Last Updated: 2026-01-04 19:14

Related Q&A

Compound Q&A

How is 2-Bromo-1H-indene-1,3(2H)-dione (CAS: 7319-63-3) typically synthesized?

2-Bromo-1H-indene-1,3(2H)-dione can be synthesized via the bromination of indene followed by dimeriz...

Compound Q&A

What industries use 2-Bromo-1H-indene-1,3(2H)-dione (CAS: 7319-63-3)?

2-Bromo-1H-indene-1,3(2H)-dione (CAS: 7319-63-3) is primarily used in the pharmaceutical and polymer...

Compound Q&A

What precautions should be taken when handling 2-Bromo-1H-indene-1,3(2H)-dione (CAS: 7319-63-3)?

When handling 2-Bromo-1H-indene-1,3(2H)-dione (CAS: 7319-63-3), it is essential to wear appropriate ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...