Compound Q&A

What industries use 1-(4-Fluoro-3-nitrophenyl)methanamine (CAS: 771581-73-8)?

Answer

1-(4-Fluoro-3-nitrophenyl)methanamine
1-(4-Fluoro-3-nitrophenyl)methanamine (CAS: 771581-73-8) is used in the pharmaceutical industry for the synthesis of certain drugs. It also finds applications in the polymer industry for the development of advanced materials, and in the chemical sensor industry for detecting specific analytes. Its ability to form stable complexes with metal ions makes it useful in various analytical applications.

About

English Name 1-(4-Fluoro-3-nitrophenyl)methanamine
Molecular Formula C7H7FN2O2
Molecular Weight 170.14 g/mol
SMILES C1=CC(=C(C=C1CN)[N+](=O)[O-])F
InChIKey UALXEVNNBBBYCG-UHFFFAOYSA-N
Last Updated: 2026-01-04 19:14

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1-(4-Fluoro-3-nitrophenyl)methanamine (CAS: 771581-73-8)?

1-(4-Fluoro-3-nitrophenyl)methanamine (CAS: 771581-73-8) is a crystalline compound with a molecular ...

Compound Q&A

How is 1-(4-Fluoro-3-nitrophenyl)methanamine (CAS: 771581-73-8) typically synthesized?

1-(4-Fluoro-3-nitrophenyl)methanamine can be synthesized by coupling 4-fluoro-3-nitrobenzoic acid wi...

Compound Q&A

What precautions should be taken when handling 1-(4-Fluoro-3-nitrophenyl)methanamine (CAS: 771581-73-8)?

When handling 1-(4-Fluoro-3-nitrophenyl)methanamine (CAS: 771581-73-8), it is important to wear appr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...