Compound Q&A

What are the physical and chemical properties of (2S,4R)-4-(3-Chlorobenzyl)pyrrolidine-2-carboxylic acid hydrochloride (CAS: 1049733-75-6)?

Answer

(2S,4R)-4-(3-Chlorobenzyl)pyrrolidine-2-carboxylic acid hydrochloride
(2S,4R)-4-(3-Chlorobenzyl)pyrrolidine-2-carboxylic acid hydrochloride is a white, crystalline solid with a molecular weight of approximately 334.72 g/mol. It is slightly soluble in water but soluble in organic solvents like ethanol and acetonitrile. This compound is known for its moderate reactivity, particularly in amide bond formation and peptide coupling reactions. It exhibits good stability under normal conditions but requires storage in a desiccator to prevent moisture absorption.

About

English Name (2S,4R)-4-(3-Chlorobenzyl)pyrrolidine-2-carboxylic acid hydrochloride
Molecular Formula C12H15Cl2NO2
Molecular Weight 276.16 g/mol
SMILES C1C(CNC1C(=O)O)CC2=CC(=CC=C2)Cl.Cl
InChIKey DJTLAJDJECIWLN-XQKZEKTMSA-N
Last Updated: 2026-01-04 19:14

Related Q&A

Compound Q&A

How is (2S,4R)-4-(3-Chlorobenzyl)pyrrolidine-2-carboxylic acid hydrochloride (CAS: 1049733-75-6) typically synthesized?

The compound (2S,4R)-4-(3-Chlorobenzyl)pyrrolidine-2-carboxylic acid hydrochloride can be synthesize...

Compound Q&A

What industries use (2S,4R)-4-(3-Chlorobenzyl)pyrrolidine-2-carboxylic acid hydrochloride (CAS: 1049733-75-6)?

(2S,4R)-4-(3-Chlorobenzyl)pyrrolidine-2-carboxylic acid hydrochloride finds application in the pharm...

Compound Q&A

What precautions should be taken when handling (2S,4R)-4-(3-Chlorobenzyl)pyrrolidine-2-carboxylic acid hydrochloride (CAS: 1049733-75-6)?

When handling (2S,4R)-4-(3-Chlorobenzyl)pyrrolidine-2-carboxylic acid hydrochloride, it is essential...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...