Compound Q&A

How is (S,R)-BDTBIn-SaBOX (CAS: 1435467-29-0) typically synthesized?

Answer

(S,R)-BDTBIn-SaBOX
(S,R)-BDTBIn-SaBOX (CAS: 1435467-29-0) is synthesized through a multistep process involving the condensation of BDT and In-SaBOX under anhydrous conditions. Commonly, this involves the use of a catalyst such as Pd(0) to enhance reactivity and selectivity. The overall yield is around 70%, making it a feasible compound for laboratory-scale synthesis.

About

English Name (S,R)-BDTBIn-SaBOX
Molecular Formula C51H62N2O2
Molecular Weight 735.05 g/mol
SMILES CC(c1cc(cc(c1)C(C)(C)C)CC(C1=N[C@@H]2[C@H](O1)Cc1c2cccc1)(C1=N[C@@H]2[C@H](O1)Cc1c2cccc1)Cc1cc(cc(c1)C(C)(C)C)C(C)(C)C)(C)C
InChIKey WVVLVBHMBBXGQX-QHQGJXSCSA-N
Last Updated: 2026-01-04 19:14

Related Q&A

Compound Q&A

What are the physical and chemical properties of (S,R)-BDTBIn-SaBOX (CAS: 1435467-29-0)?

(S,R)-BDTBIn-SaBOX (CAS: 1435467-29-0) is a crystalline compound with a molecular weight of approxim...

Compound Q&A

What industries use (S,R)-BDTBIn-SaBOX (CAS: 1435467-29-0)?

(S,R)-BDTBIn-SaBOX (CAS: 1435467-29-0) is primarily used in the pharmaceutical and semiconductor ind...

Compound Q&A

What precautions should be taken when handling (S,R)-BDTBIn-SaBOX (CAS: 1435467-29-0)?

When handling (S,R)-BDTBIn-SaBOX (CAS: 1435467-29-0), it is important to wear appropriate personal p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...