Compound Q&A

What are the physical and chemical properties of (S,R)-BDTBIn-SaBOX (CAS: 1435467-29-0)?

Answer

(S,R)-BDTBIn-SaBOX
(S,R)-BDTBIn-SaBOX (CAS: 1435467-29-0) is a crystalline compound with a molecular weight of approximately 732.28 g/mol. It has a high solubility in organic solvents like THF and DMSO. Chemically, it is relatively stable under normal conditions but reacts with strong acids and bases. This compound is often used in organic synthesis due to its unique structural features.

About

English Name (S,R)-BDTBIn-SaBOX
Molecular Formula C51H62N2O2
Molecular Weight 735.05 g/mol
SMILES CC(c1cc(cc(c1)C(C)(C)C)CC(C1=N[C@@H]2[C@H](O1)Cc1c2cccc1)(C1=N[C@@H]2[C@H](O1)Cc1c2cccc1)Cc1cc(cc(c1)C(C)(C)C)C(C)(C)C)(C)C
InChIKey WVVLVBHMBBXGQX-QHQGJXSCSA-N
Last Updated: 2026-01-04 19:14

Related Q&A

Compound Q&A

How is (S,R)-BDTBIn-SaBOX (CAS: 1435467-29-0) typically synthesized?

(S,R)-BDTBIn-SaBOX (CAS: 1435467-29-0) is synthesized through a multistep process involving the cond...

Compound Q&A

What industries use (S,R)-BDTBIn-SaBOX (CAS: 1435467-29-0)?

(S,R)-BDTBIn-SaBOX (CAS: 1435467-29-0) is primarily used in the pharmaceutical and semiconductor ind...

Compound Q&A

What precautions should be taken when handling (S,R)-BDTBIn-SaBOX (CAS: 1435467-29-0)?

When handling (S,R)-BDTBIn-SaBOX (CAS: 1435467-29-0), it is important to wear appropriate personal p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...