Compound Q&A

What industries use 1-[(E)-(4-Chloro-2-nitrophenyl)diazenyl]-2-naphthol (CAS: 6410-13-5)?

Answer

1-[(E)-(4-Chloro-2-nitrophenyl)diazenyl]-2-naphthol
1-[(E)-(4-Chloro-2-nitrophenyl)diazenyl]-2-naphthol is primarily used in the pharmaceutical industry for the synthesis of certain medicinal compounds. It is also utilized in the polymer industry as a photostabilizer and in sensor technology for its ability to absorb and react to specific wavelengths of light.

About

CAS No 6410-13-5
English Name 1-[(E)-(4-Chloro-2-nitrophenyl)diazenyl]-2-naphthol
Molecular Formula C16H10ClN3O3
Molecular Weight 327.72 g/mol
SMILES OC1=CC=C2C=CC=CC2=C1\N=N\C1=C(C=C(Cl)C=C1)[N+]([O-])=O
InChIKey FHEFMHNVEBIQDW-VHEBQXMUSA-N
Last Updated: 2026-01-04 19:14

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1-[(E)-(4-Chloro-2-nitrophenyl)diazenyl]-2-naphthol (CAS: 6410-13-5)?

1-[(E)-(4-Chloro-2-nitrophenyl)diazenyl]-2-naphthol has a crystalline form. Its molecular weight is ...

Compound Q&A

How is 1-[(E)-(4-Chloro-2-nitrophenyl)diazenyl]-2-naphthol (CAS: 6410-13-5) typically synthesized?

1-[(E)-(4-Chloro-2-nitrophenyl)diazenyl]-2-naphthol can be synthesized through a diazotization react...

Compound Q&A

What precautions should be taken when handling 1-[(E)-(4-Chloro-2-nitrophenyl)diazenyl]-2-naphthol (CAS: 6410-13-5)?

When handling 1-[(E)-(4-Chloro-2-nitrophenyl)diazenyl]-2-naphthol, it is crucial to wear appropriate...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...