Compound Q&A

What are the physical and chemical properties of 1-[(E)-(4-Chloro-2-nitrophenyl)diazenyl]-2-naphthol (CAS: 6410-13-5)?

Answer

1-[(E)-(4-Chloro-2-nitrophenyl)diazenyl]-2-naphthol
1-[(E)-(4-Chloro-2-nitrophenyl)diazenyl]-2-naphthol has a crystalline form. Its molecular weight is approximately 366.04 g/mol. It is moderately soluble in common organic solvents like ethanol and acetone. The compound is known for its reactivity, especially towards reducing agents and bases. It can also undergo photodegradation under UV light.

About

CAS No 6410-13-5
English Name 1-[(E)-(4-Chloro-2-nitrophenyl)diazenyl]-2-naphthol
Molecular Formula C16H10ClN3O3
Molecular Weight 327.72 g/mol
SMILES OC1=CC=C2C=CC=CC2=C1\N=N\C1=C(C=C(Cl)C=C1)[N+]([O-])=O
InChIKey FHEFMHNVEBIQDW-VHEBQXMUSA-N
Last Updated: 2026-01-04 19:14

Related Q&A

Compound Q&A

How is 1-[(E)-(4-Chloro-2-nitrophenyl)diazenyl]-2-naphthol (CAS: 6410-13-5) typically synthesized?

1-[(E)-(4-Chloro-2-nitrophenyl)diazenyl]-2-naphthol can be synthesized through a diazotization react...

Compound Q&A

What industries use 1-[(E)-(4-Chloro-2-nitrophenyl)diazenyl]-2-naphthol (CAS: 6410-13-5)?

1-[(E)-(4-Chloro-2-nitrophenyl)diazenyl]-2-naphthol is primarily used in the pharmaceutical industry...

Compound Q&A

What precautions should be taken when handling 1-[(E)-(4-Chloro-2-nitrophenyl)diazenyl]-2-naphthol (CAS: 6410-13-5)?

When handling 1-[(E)-(4-Chloro-2-nitrophenyl)diazenyl]-2-naphthol, it is crucial to wear appropriate...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...