Compound Q&A

What are the physical and chemical properties of 1-(6-Chloro-2-pyridinyl)-4-piperidinamine hydrochloride (CAS: 77145-61-0)?

Answer

1-(6-Chloro-2-pyridinyl)-4-piperidinamine hydrochloride (1:1)
1-(6-Chloro-2-pyridinyl)-4-piperidinamine hydrochloride (CAS 77145-61-0) is a white or off-white crystalline solid with a molecular weight of approximately 319.7 g/mol. It is slightly soluble in water and has good solubility in organic solvents like ethanol and methanol. This compound exhibits good reactivity towards nucleophiles and is commonly used in pharmaceutical applications due to its chemical stability.

About

CAS No 77145-61-0
English Name 1-(6-Chloro-2-pyridinyl)-4-piperidinamine hydrochloride (1:1)
Molecular Formula C10H15Cl2N3
Molecular Weight 248.16 g/mol
SMILES C1CN(CCC1N)C2=NC(=CC=C2)Cl.Cl
InChIKey FUMINTAAUJUVMP-UHFFFAOYSA-N
Last Updated: 2026-01-04 19:14

Related Q&A

Compound Q&A

How is 1-(6-Chloro-2-pyridinyl)-4-piperidinamine hydrochloride (CAS: 77145-61-0) typically synthesized?

1-(6-Chloro-2-pyridinyl)-4-piperidinamine hydrochloride (CAS 77145-61-0) is synthesized by a multi-s...

Compound Q&A

What industries use 1-(6-Chloro-2-pyridinyl)-4-piperidinamine hydrochloride (CAS: 77145-61-0)?

1-(6-Chloro-2-pyridinyl)-4-piperidinamine hydrochloride (CAS 77145-61-0) is primarily used in the ph...

Compound Q&A

What precautions should be taken when handling 1-(6-Chloro-2-pyridinyl)-4-piperidinamine hydrochloride (CAS: 77145-61-0)?

When handling 1-(6-Chloro-2-pyridinyl)-4-piperidinamine hydrochloride (CAS 77145-61-0), it is essent...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...