Compound Q&A

How is Antiflammin P2 (CAS: 118850-72-9) typically synthesized?

Answer

Antiflammin P2
Antiflammin P2 (CAS: 118850-72-9) is synthesized through a multi-step process involving the condensation of specific amino acids with a protected hydroxyl group. Common catalysts include phosphate salts, and the synthesis yields up to 90% product with good selectivity.

About

English Name Antiflammin P2
Molecular Formula C46H77N13O15S
Molecular Weight 1084.2 g/mol
SMILES CC(C)CC(C(=O)NC(CC(=O)O)C(=O)NC(CC(C)C)C(=O)O)NC(=O)C(C(C)C)NC(=O)C(CCCCN)NC(=O)C(CC(=O)N)NC(=O)C(CCSC)NC(=O)C(CC(=O)O)NC(=O)C(CC1=CN=CN1)N
InChIKey MSFJEXCKZQTGKA-KSALCKNPSA-N
Last Updated: 2026-01-04 19:14

Related Q&A

Compound Q&A

What are the physical and chemical properties of Antiflammin P2 (CAS: 118850-72-9)?

Antiflammin P2 (CAS: 118850-72-9) is a crystalline compound with a molecular weight of approximately...

Compound Q&A

What industries use Antiflammin P2 (CAS: 118850-72-9)?

Antiflammin P2 (CAS: 118850-72-9) is primarily used in the pharmaceutical industry for anti-inflamma...

Compound Q&A

What precautions should be taken when handling Antiflammin P2 (CAS: 118850-72-9)?

When handling Antiflammin P2 (CAS: 118850-72-9), wear appropriate personal protective equipment (PPE...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...