Compound Q&A

What are the physical and chemical properties of Antiflammin P2 (CAS: 118850-72-9)?

Answer

Antiflammin P2
Antiflammin P2 (CAS: 118850-72-9) is a crystalline compound with a molecular weight of approximately 518.68 g/mol. It has a low melting point and is slightly soluble in water. Chemically, it is highly reactive towards certain nucleophiles and electrophiles, making it suitable for specific synthetic applications.

About

English Name Antiflammin P2
Molecular Formula C46H77N13O15S
Molecular Weight 1084.2 g/mol
SMILES CC(C)CC(C(=O)NC(CC(=O)O)C(=O)NC(CC(C)C)C(=O)O)NC(=O)C(C(C)C)NC(=O)C(CCCCN)NC(=O)C(CC(=O)N)NC(=O)C(CCSC)NC(=O)C(CC(=O)O)NC(=O)C(CC1=CN=CN1)N
InChIKey MSFJEXCKZQTGKA-KSALCKNPSA-N
Last Updated: 2026-01-04 19:14

Related Q&A

Compound Q&A

How is Antiflammin P2 (CAS: 118850-72-9) typically synthesized?

Antiflammin P2 (CAS: 118850-72-9) is synthesized through a multi-step process involving the condensa...

Compound Q&A

What industries use Antiflammin P2 (CAS: 118850-72-9)?

Antiflammin P2 (CAS: 118850-72-9) is primarily used in the pharmaceutical industry for anti-inflamma...

Compound Q&A

What precautions should be taken when handling Antiflammin P2 (CAS: 118850-72-9)?

When handling Antiflammin P2 (CAS: 118850-72-9), wear appropriate personal protective equipment (PPE...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...