Compound Q&A

How should (2,3,4-Trimethoxyphenyl)acetic acid (CAS: 22480-91-7) be stored?

Answer

(2,3,4-Trimethoxyphenyl)acetic acid
(2,3,4-Trimethoxyphenyl)acetic acid should be stored in a cool, dry place, protected from moisture and light. Store at room temperature (15-25°C) and in a tightly sealed container to prevent degradation. Avoid storing near heat sources or direct sunlight, and keep away from incompatible substances such as strong acids or oxidizers.

About

CAS No 22480-91-7
English Name (2,3,4-Trimethoxyphenyl)acetic acid
Molecular Formula C11H14O5
Molecular Weight 226.23 g/mol
SMILES COC1=C(C(=C(C=C1)CC(=O)O)OC)OC
InChIKey ZMWCKCLDAQWIDA-UHFFFAOYSA-N
Last Updated: 2026-01-04 05:07

Related Q&A

Compound Q&A

What is (2,3,4-Trimethoxyphenyl)acetic acid (CAS: 22480-91-7)?

(2,3,4-Trimethoxyphenyl)acetic acid is a phenolic acid with the molecular formula C11H14O5. It featu...

Compound Q&A

What are the main uses of (2,3,4-Trimethoxyphenyl)acetic acid (CAS: 22480-91-7)?

(2,3,4-Trimethoxyphenyl)acetic acid is primarily used in the pharmaceutical industry as an intermedi...

Compound Q&A

Is (2,3,4-Trimethoxyphenyl)acetic acid (CAS: 22480-91-7) safe?

(2,3,4-Trimethoxyphenyl)acetic acid is generally considered safe under normal handling conditions. H...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...