Compound Q&A

Is (2,3,4-Trimethoxyphenyl)acetic acid (CAS: 22480-91-7) safe?

Answer

(2,3,4-Trimethoxyphenyl)acetic acid
(2,3,4-Trimethoxyphenyl)acetic acid is generally considered safe under normal handling conditions. However, it should be used with caution as it may cause skin irritation. Proper protective equipment, such as gloves and goggles, should be worn during handling. Avoid contact with eyes and skin, and ensure proper ventilation.

About

CAS No 22480-91-7
English Name (2,3,4-Trimethoxyphenyl)acetic acid
Molecular Formula C11H14O5
Molecular Weight 226.23 g/mol
SMILES COC1=C(C(=C(C=C1)CC(=O)O)OC)OC
InChIKey ZMWCKCLDAQWIDA-UHFFFAOYSA-N
Last Updated: 2026-01-04 05:07

Related Q&A

Compound Q&A

What is (2,3,4-Trimethoxyphenyl)acetic acid (CAS: 22480-91-7)?

(2,3,4-Trimethoxyphenyl)acetic acid is a phenolic acid with the molecular formula C11H14O5. It featu...

Compound Q&A

What are the main uses of (2,3,4-Trimethoxyphenyl)acetic acid (CAS: 22480-91-7)?

(2,3,4-Trimethoxyphenyl)acetic acid is primarily used in the pharmaceutical industry as an intermedi...

Compound Q&A

How should (2,3,4-Trimethoxyphenyl)acetic acid (CAS: 22480-91-7) be stored?

(2,3,4-Trimethoxyphenyl)acetic acid should be stored in a cool, dry place, protected from moisture a...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...