Compound Q&A

How should (4-Methoxybenzyl)(triphenyl)phosphonium chloride (CAS: 3462-97-3) be stored?

Answer

(4-Methoxybenzyl)(triphenyl)phosphonium chloride
(4-Methoxybenzyl)(triphenyl)phosphonium chloride should be stored in a cool, dry place, away from direct sunlight and heat sources. It should be kept in a tightly sealed container to prevent moisture absorption and contamination. Avoid contact with air and other reactive substances.

About

CAS No 3462-97-3
English Name (4-Methoxybenzyl)(triphenyl)phosphonium chloride
Molecular Formula C26H24ClOP
Molecular Weight 418.9 g/mol
SMILES COC1=CC=C(C=C1)C[P+](C2=CC=CC=C2)(C3=CC=CC=C3)C4=CC=CC=C4.[Cl-]
InChIKey YQXBNCFNXOFWLR-UHFFFAOYSA-M
Last Updated: 2026-01-03 23:08

Related Q&A

Compound Q&A

What is (4-Methoxybenzyl)(triphenyl)phosphonium chloride (CAS: 3462-97-3)?

(4-Methoxybenzyl)(triphenyl)phosphonium chloride, CAS 3462-97-3, is an organophosphorus compound wit...

Compound Q&A

What are the main uses of (4-Methoxybenzyl)(triphenyl)phosphonium chloride (CAS: 3462-97-3)?

(4-Methoxybenzyl)(triphenyl)phosphonium chloride is primarily used in the synthesis of other organic...

Compound Q&A

Is (4-Methoxybenzyl)(triphenyl)phosphonium chloride (CAS: 3462-97-3) safe?

(4-Methoxybenzyl)(triphenyl)phosphonium chloride is generally considered safe for laboratory use whe...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...