Compound Q&A

Is (4-Methoxybenzyl)(triphenyl)phosphonium chloride (CAS: 3462-97-3) safe?

Answer

(4-Methoxybenzyl)(triphenyl)phosphonium chloride
(4-Methoxybenzyl)(triphenyl)phosphonium chloride is generally considered safe for laboratory use when proper precautions are taken. However, it should be handled with care, as it may cause skin irritation and eye irritation. Protective gloves and safety glasses should be worn when handling the compound.

About

CAS No 3462-97-3
English Name (4-Methoxybenzyl)(triphenyl)phosphonium chloride
Molecular Formula C26H24ClOP
Molecular Weight 418.9 g/mol
SMILES COC1=CC=C(C=C1)C[P+](C2=CC=CC=C2)(C3=CC=CC=C3)C4=CC=CC=C4.[Cl-]
InChIKey YQXBNCFNXOFWLR-UHFFFAOYSA-M
Last Updated: 2026-01-03 23:08

Related Q&A

Compound Q&A

What is (4-Methoxybenzyl)(triphenyl)phosphonium chloride (CAS: 3462-97-3)?

(4-Methoxybenzyl)(triphenyl)phosphonium chloride, CAS 3462-97-3, is an organophosphorus compound wit...

Compound Q&A

What are the main uses of (4-Methoxybenzyl)(triphenyl)phosphonium chloride (CAS: 3462-97-3)?

(4-Methoxybenzyl)(triphenyl)phosphonium chloride is primarily used in the synthesis of other organic...

Compound Q&A

How should (4-Methoxybenzyl)(triphenyl)phosphonium chloride (CAS: 3462-97-3) be stored?

(4-Methoxybenzyl)(triphenyl)phosphonium chloride should be stored in a cool, dry place, away from di...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...