Compound Q&A

How should Pyrroside B (CAS: 116271-35-3) be stored?

Answer

Pyrroside B
Pyrroside B (CAS: 116271-35-3) should be stored in a cool, dry place away from direct sunlight and moisture. It is recommended to store it in a sealed container to prevent degradation. The optimal storage temperature is below 25°C.

About

English Name Pyrroside B
Molecular Formula C26H30O14
Molecular Weight 566.5 g/mol
SMILES C1C(OC2=CC(=CC(=C2C1=O)O)OC3C(C(C(C(O3)COC4C(C(CO4)(CO)O)O)O)O)O)C5=CC=C(C=C5)O
InChIKey NWNGXQLQGVWVHC-URWLGXSFSA-N
Last Updated: 2026-01-03 12:17

Related Q&A

Compound Q&A

What is Pyrroside B (CAS: 116271-35-3)?

Pyrroside B (CAS: 116271-35-3) is a natural polyphenolic compound found in some plants. It has a che...

Compound Q&A

What are the main uses of Pyrroside B (CAS: 116271-35-3)?

Pyrroside B (CAS: 116271-35-3) is used in the food industry as a natural antioxidant. It is also stu...

Compound Q&A

Is Pyrroside B (CAS: 116271-35-3) safe?

Pyrroside B (CAS: 116271-35-3) is considered safe for use in food and cosmetics. However, it is advi...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...