Compound Q&A

Is Pyrroside B (CAS: 116271-35-3) safe?

Answer

Pyrroside B
Pyrroside B (CAS: 116271-35-3) is considered safe for use in food and cosmetics. However, it is advisable to handle it with care and follow standard safety procedures, including wearing appropriate protective equipment.

About

English Name Pyrroside B
Molecular Formula C26H30O14
Molecular Weight 566.5 g/mol
SMILES C1C(OC2=CC(=CC(=C2C1=O)O)OC3C(C(C(C(O3)COC4C(C(CO4)(CO)O)O)O)O)O)C5=CC=C(C=C5)O
InChIKey NWNGXQLQGVWVHC-URWLGXSFSA-N
Last Updated: 2026-01-03 12:17

Related Q&A

Compound Q&A

What is Pyrroside B (CAS: 116271-35-3)?

Pyrroside B (CAS: 116271-35-3) is a natural polyphenolic compound found in some plants. It has a che...

Compound Q&A

What are the main uses of Pyrroside B (CAS: 116271-35-3)?

Pyrroside B (CAS: 116271-35-3) is used in the food industry as a natural antioxidant. It is also stu...

Compound Q&A

How should Pyrroside B (CAS: 116271-35-3) be stored?

Pyrroside B (CAS: 116271-35-3) should be stored in a cool, dry place away from direct sunlight and m...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...