Compound Q&A

How should 4-[(Diphenylcarbamoyl)oxy]-3-nitrobenzoic acid (CAS: 10556-88-4) be stored?

Answer

4-[(Diphenylcarbamoyl)oxy]-3-nitrobenzoic acid
4-[(Diphenylcarbamoyl)oxy]-3-nitrobenzoic acid (CAS: 10556-88-4) should be stored in a cool, dry place away from direct sunlight and heat sources. It is recommended to store it in a tightly sealed container to prevent degradation and maintain its stability.

About

CAS No 10556-88-4
English Name 4-[(Diphenylcarbamoyl)oxy]-3-nitrobenzoic acid
Molecular Formula C20H14N2O6
Molecular Weight 378.33 g/mol
SMILES c1ccc(cc1)N(c2ccccc2)C(=O)Oc3ccc(cc3[N+](=O)[O-])C(=O)O
InChIKey RLNYDAFUTZRAIW-UHFFFAOYSA-N
Last Updated: 2026-01-03 08:41

Related Q&A

Compound Q&A

What is 4-[(Diphenylcarbamoyl)oxy]-3-nitrobenzoic acid (CAS: 10556-88-4)?

4-[(Diphenylcarbamoyl)oxy]-3-nitrobenzoic acid (CAS: 10556-88-4) is a organic compound with the mole...

Compound Q&A

What are the main uses of 4-[(Diphenylcarbamoyl)oxy]-3-nitrobenzoic acid (CAS: 10556-88-4)?

4-[(Diphenylcarbamoyl)oxy]-3-nitrobenzoic acid (CAS: 10556-88-4) is primarily used in pharmaceutical...

Compound Q&A

Is 4-[(Diphenylcarbamoyl)oxy]-3-nitrobenzoic acid (CAS: 10556-88-4) safe?

4-[(Diphenylcarbamoyl)oxy]-3-nitrobenzoic acid (CAS: 10556-88-4) is generally safe when handled with...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...