Compound Q&A

What is 4-[(Diphenylcarbamoyl)oxy]-3-nitrobenzoic acid (CAS: 10556-88-4)?

Answer

4-[(Diphenylcarbamoyl)oxy]-3-nitrobenzoic acid
4-[(Diphenylcarbamoyl)oxy]-3-nitrobenzoic acid (CAS: 10556-88-4) is a organic compound with the molecular formula C21H15NO7. It is characterized by its aromatic ring structure and contains nitro and carbamoyl groups. This compound is often used in research and industrial applications due to its unique chemical properties.

About

CAS No 10556-88-4
English Name 4-[(Diphenylcarbamoyl)oxy]-3-nitrobenzoic acid
Molecular Formula C20H14N2O6
Molecular Weight 378.33 g/mol
SMILES c1ccc(cc1)N(c2ccccc2)C(=O)Oc3ccc(cc3[N+](=O)[O-])C(=O)O
InChIKey RLNYDAFUTZRAIW-UHFFFAOYSA-N
Last Updated: 2026-01-03 08:41

Related Q&A

Compound Q&A

What are the main uses of 4-[(Diphenylcarbamoyl)oxy]-3-nitrobenzoic acid (CAS: 10556-88-4)?

4-[(Diphenylcarbamoyl)oxy]-3-nitrobenzoic acid (CAS: 10556-88-4) is primarily used in pharmaceutical...

Compound Q&A

Is 4-[(Diphenylcarbamoyl)oxy]-3-nitrobenzoic acid (CAS: 10556-88-4) safe?

4-[(Diphenylcarbamoyl)oxy]-3-nitrobenzoic acid (CAS: 10556-88-4) is generally safe when handled with...

Compound Q&A

How should 4-[(Diphenylcarbamoyl)oxy]-3-nitrobenzoic acid (CAS: 10556-88-4) be stored?

4-[(Diphenylcarbamoyl)oxy]-3-nitrobenzoic acid (CAS: 10556-88-4) should be stored in a cool, dry pla...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...