Compound Q&A

How should 3-(2,3-Difluorophenyl)acrylic acid (CAS: 207981-48-4) be stored?

Answer

3-(2,3-Difluorophenyl)acrylic acid
3-(2,3-Difluorophenyl)acrylic acid should be stored in a cool, dry place, away from direct sunlight and heat sources. It should be kept in a tightly sealed container to prevent moisture and air exposure. Optimal storage conditions include a temperature range of 15-25°C and a relative humidity below 50%.

About

English Name 3-(2,3-Difluorophenyl)acrylic acid
Molecular Formula C9H6F2O2
Molecular Weight 184.14 g/mol
SMILES C1=CC(=C(C(=C1)F)F)C=CC(=O)O
InChIKey NVQHKPLMLCHFSU-UHFFFAOYSA-N
Last Updated: 2026-01-03 05:32

Related Q&A

Compound Q&A

What is 3-(2,3-Difluorophenyl)acrylic acid (CAS: 207981-48-4)?

3-(2,3-Difluorophenyl)acrylic acid (CAS: 207981-48-4) is a synthetic compound characterized by its m...

Compound Q&A

What are the main uses of 3-(2,3-Difluorophenyl)acrylic acid (CAS: 207981-48-4)?

3-(2,3-Difluorophenyl)acrylic acid is primarily used in the synthesis of pharmaceuticals and as an i...

Compound Q&A

Is 3-(2,3-Difluorophenyl)acrylic acid (CAS: 207981-48-4) safe?

3-(2,3-Difluorophenyl)acrylic acid is generally safe when handled with appropriate precautions. Howe...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...