Compound Q&A

What is 3-(2,3-Difluorophenyl)acrylic acid (CAS: 207981-48-4)?

Answer

3-(2,3-Difluorophenyl)acrylic acid
3-(2,3-Difluorophenyl)acrylic acid (CAS: 207981-48-4) is a synthetic compound characterized by its molecular formula C8H6F2COOH. This acidic compound features a phenyl ring with two fluorine atoms substituents, attached to an acrylic acid group. It is commonly used in pharmaceutical and chemical research due to its unique structural properties.

About

English Name 3-(2,3-Difluorophenyl)acrylic acid
Molecular Formula C9H6F2O2
Molecular Weight 184.14 g/mol
SMILES C1=CC(=C(C(=C1)F)F)C=CC(=O)O
InChIKey NVQHKPLMLCHFSU-UHFFFAOYSA-N
Last Updated: 2026-01-03 05:32

Related Q&A

Compound Q&A

What are the main uses of 3-(2,3-Difluorophenyl)acrylic acid (CAS: 207981-48-4)?

3-(2,3-Difluorophenyl)acrylic acid is primarily used in the synthesis of pharmaceuticals and as an i...

Compound Q&A

Is 3-(2,3-Difluorophenyl)acrylic acid (CAS: 207981-48-4) safe?

3-(2,3-Difluorophenyl)acrylic acid is generally safe when handled with appropriate precautions. Howe...

Compound Q&A

How should 3-(2,3-Difluorophenyl)acrylic acid (CAS: 207981-48-4) be stored?

3-(2,3-Difluorophenyl)acrylic acid should be stored in a cool, dry place, away from direct sunlight ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...