Compound Q&A

Are there alternatives to Bis(4-chlorophenyl)acetic acid (CAS: 83-05-6) in synthesis?

Answer

Bis(4-chlorophenyl)acetic acid
Alternatives to Bis(4-chlorophenyl)acetic acid (CAS: 83-05-6) in synthesis include other acetic acid derivatives, such as 2-chlorobenzoic acid, 4-chloroacetophenone, and 4-chlorobenzenesulfonic acid. These compounds can serve similar roles depending on the specific reaction conditions and desired product.

About

CAS No 83-05-6
English Name Bis(4-chlorophenyl)acetic acid
Molecular Formula C14H10Cl2O2
Molecular Weight 281.14 g/mol
SMILES O=C(O)C(C1=CC=C(Cl)C=C1)C2=CC=C(Cl)C=C2
InChIKey YIOCIFXUGBYCJR-UHFFFAOYSA-N
Last Updated: 2026-01-02 07:09

Related Q&A

Compound Q&A

What regulatory guidelines apply to Bis(4-chlorophenyl)acetic acid (CAS: 83-05-6)?

Bis(4-chlorophenyl)acetic acid (CAS: 83-05-6) must comply with regulatory guidelines such as the Glo...

Compound Q&A

What is the market or research trend for Bis(4-chlorophenyl)acetic acid (CAS: 83-05-6)?

The market for Bis(4-chlorophenyl)acetic acid (CAS: 83-05-6) shows a steady demand driven by its use...

Compound Q&A

How should waste containing Bis(4-chlorophenyl)acetic acid (CAS: 83-05-6) be handled?

Waste containing Bis(4-chlorophenyl)acetic acid (CAS: 83-05-6) should be collected in a sealed conta...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...