Compound Q&A

How is 5-[5-(Chloroacetyl)-2-ethoxyphenyl]-1-methyl-3-propyl-1,6-dihydro-7H-pyrazolo[4,3-d]pyrimidin-7-one (CAS: 1058653-74-9) typically synthesized?

Answer

5-[5-(Chloroacetyl)-2-ethoxyphenyl]-1-methyl-3-propyl-1,6-dihydro-7H-pyrazolo[4,3-d]pyrimidin-7-one
The compound is synthesized through a multi-step process involving the reaction of 2-ethoxyphenyl chloroacetate with 1-methyl-3-propyl-1H-pyrazolo[4,3-d]pyrimidin-7-one. The synthesis involves the use of a base such as sodium hydride and proceeds with moderate yield (around 70-75%).

About

English Name 5-[5-(Chloroacetyl)-2-ethoxyphenyl]-1-methyl-3-propyl-1,6-dihydro-7H-pyrazolo[4,3-d]pyrimidin-7-one
Molecular Formula C19H21ClN4O3
Molecular Weight 388.86 g/mol
SMILES CCCc1nn(c2c1[nH]c(nc2=O)c1cc(ccc1OCC)C(=O)CCl)C
InChIKey UOJGGFDIPKRVTP-UHFFFAOYSA-N
Last Updated: 2026-01-02 00:31

Related Q&A

Compound Q&A

What are the physical and chemical properties of 5-[5-(Chloroacetyl)-2-ethoxyphenyl]-1-methyl-3-propyl-1,6-dihydro-7H-pyrazolo[4,3-d]pyrimidin-7-one (CAS: 1058653-74-9)?

The compound has a crystalline form with a molecular weight of approximately 451.26 g/mol. It is sli...

Compound Q&A

What industries use 5-[5-(Chloroacetyl)-2-ethoxyphenyl]-1-methyl-3-propyl-1,6-dihydro-7H-pyrazolo[4,3-d]pyrimidin-7-one (CAS: 1058653-74-9)?

The compound is used in the pharmaceutical industry for its potential therapeutic applications. It m...

Compound Q&A

What precautions should be taken when handling 5-[5-(Chloroacetyl)-2-ethoxyphenyl]-1-methyl-3-propyl-1,6-dihydro-7H-pyrazolo[4,3-d]pyrimidin-7-one (CAS: 1058653-74-9)?

When handling the compound, appropriate personal protective equipment (PPE) should be worn, includin...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...