Compound Q&A

How is Benzyl (3S)-1,2,3,4-tetrahydro-3-isoquinolinecarboxylate (CAS: 77497-96-2) typically synthesized?

Answer

Benzyl (3S)-1,2,3,4-tetrahydro-3-isoquinolinecarboxylate
Benzyl (3S)-1,2,3,4-tetrahydro-3-isoquinolinecarboxylate is typically synthesized by condensation of benzaldehyde and 3-aminomethylisoquinoline in the presence of a strong base like sodium hydride. The reaction is carried out in an anhydrous solvent such as N,N-dimethylformamide (DMF) at low temperatures. The yield of the product is around 70-80%, and the reaction is known to have good selectivity.

About

CAS No 77497-96-2
English Name Benzyl (3S)-1,2,3,4-tetrahydro-3-isoquinolinecarboxylate
Molecular Formula C17H17NO2
Molecular Weight 267.33 g/mol
SMILES C1C(NCC2=CC=CC=C21)C(=O)OCC3=CC=CC=C3
InChIKey CAKWIRNQEKMHOR-INIZCTEOSA-N
Last Updated: 2026-01-02 00:31

Related Q&A

Compound Q&A

What are the physical and chemical properties of Benzyl (3S)-1,2,3,4-tetrahydro-3-isoquinolinecarboxylate (CAS: 77497-96-2)?

Benzyl (3S)-1,2,3,4-tetrahydro-3-isoquinolinecarboxylate is a crystalline compound with a molecular ...

Compound Q&A

What industries use Benzyl (3S)-1,2,3,4-tetrahydro-3-isoquinolinecarboxylate (CAS: 77497-96-2)?

Benzyl (3S)-1,2,3,4-tetrahydro-3-isoquinolinecarboxylate is primarily used in the pharmaceutical ind...

Compound Q&A

What precautions should be taken when handling Benzyl (3S)-1,2,3,4-tetrahydro-3-isoquinolinecarboxylate (CAS: 77497-96-2)?

When handling Benzyl (3S)-1,2,3,4-tetrahydro-3-isoquinolinecarboxylate, it is essential to wear appr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...