Compound Q&A

What are the physical and chemical properties of Benzyl (3S)-1,2,3,4-tetrahydro-3-isoquinolinecarboxylate (CAS: 77497-96-2)?

Answer

Benzyl (3S)-1,2,3,4-tetrahydro-3-isoquinolinecarboxylate
Benzyl (3S)-1,2,3,4-tetrahydro-3-isoquinolinecarboxylate is a crystalline compound with a molecular weight of approximately 256.33 g/mol. It has a high solubility in organic solvents such as ethanol and acetone but is sparingly soluble in water. The compound is relatively stable under normal conditions but may undergo depolymerization when exposed to strong bases or high temperatures. It is used in the synthesis of pharmaceuticals and other organic compounds.

About

CAS No 77497-96-2
English Name Benzyl (3S)-1,2,3,4-tetrahydro-3-isoquinolinecarboxylate
Molecular Formula C17H17NO2
Molecular Weight 267.33 g/mol
SMILES C1C(NCC2=CC=CC=C21)C(=O)OCC3=CC=CC=C3
InChIKey CAKWIRNQEKMHOR-INIZCTEOSA-N
Last Updated: 2026-01-02 00:31

Related Q&A

Compound Q&A

How is Benzyl (3S)-1,2,3,4-tetrahydro-3-isoquinolinecarboxylate (CAS: 77497-96-2) typically synthesized?

Benzyl (3S)-1,2,3,4-tetrahydro-3-isoquinolinecarboxylate is typically synthesized by condensation of...

Compound Q&A

What industries use Benzyl (3S)-1,2,3,4-tetrahydro-3-isoquinolinecarboxylate (CAS: 77497-96-2)?

Benzyl (3S)-1,2,3,4-tetrahydro-3-isoquinolinecarboxylate is primarily used in the pharmaceutical ind...

Compound Q&A

What precautions should be taken when handling Benzyl (3S)-1,2,3,4-tetrahydro-3-isoquinolinecarboxylate (CAS: 77497-96-2)?

When handling Benzyl (3S)-1,2,3,4-tetrahydro-3-isoquinolinecarboxylate, it is essential to wear appr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...