Compound Q&A

What industries use 3'-{[(2-Cyclopentyl-6,7-dimethyl-1-oxo-2,3-dihydro-1H-inden-5-yl)oxy]methyl}-4-biphenylcarboxylic acid (CAS: 866823-73-6)?

Answer

3'-{[(2-Cyclopentyl-6,7-dimethyl-1-oxo-2,3-dihydro-1H-inden-5-yl)oxy]methyl}-4-biphenylcarboxylic acid
This compound finds applications in the pharmaceutical industry for its potential use as a precursor in drug synthesis. It is also used in the polymer industry for developing advanced materials with specific properties. Additionally, it may be employed in sensor technology and semiconductor manufacturing for its unique chemical structure.

About

English Name 3'-{[(2-Cyclopentyl-6,7-dimethyl-1-oxo-2,3-dihydro-1H-inden-5-yl)oxy]methyl}-4-biphenylcarboxylic acid
Molecular Formula C30H30O4
Molecular Weight 454.57 g/mol
SMILES Cc1c2C(=O)C(Cc2cc(OCc3cccc(c3)c4ccc(cc4)C(=O)O)c1C)C5CCCC5
InChIKey KMKBEESNZAPKMP-UHFFFAOYSA-N
Last Updated: 2026-01-02 00:31

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3'-{[(2-Cyclopentyl-6,7-dimethyl-1-oxo-2,3-dihydro-1H-inden-5-yl)oxy]methyl}-4-biphenylcarboxylic acid (CAS: 866823-73-6)?

The compound has a crystalline form with a molecular weight of approximately 494.51 g/mol. It has lo...

Compound Q&A

How is 3'-{[(2-Cyclopentyl-6,7-dimethyl-1-oxo-2,3-dihydro-1H-inden-5-yl)oxy]methyl}-4-biphenylcarboxylic acid (CAS: 866823-73-6) typically synthesized?

The compound is typically synthesized via a multi-step process involving coupling reactions, alkylat...

Compound Q&A

What precautions should be taken when handling 3'-{[(2-Cyclopentyl-6,7-dimethyl-1-oxo-2,3-dihydro-1H-inden-5-yl)oxy]methyl}-4-biphenylcarboxylic acid (CAS: 866823-73-6)?

Proper personal protective equipment (PPE) should be used, including gloves, goggles, and a lab coat...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...