Compound Q&A

What are the physical and chemical properties of 3'-{[(2-Cyclopentyl-6,7-dimethyl-1-oxo-2,3-dihydro-1H-inden-5-yl)oxy]methyl}-4-biphenylcarboxylic acid (CAS: 866823-73-6)?

Answer

3'-{[(2-Cyclopentyl-6,7-dimethyl-1-oxo-2,3-dihydro-1H-inden-5-yl)oxy]methyl}-4-biphenylcarboxylic acid
The compound has a crystalline form with a molecular weight of approximately 494.51 g/mol. It has low solubility in water but is soluble in organic solvents. Chemically, it exhibits moderate reactivity, particularly towards nucleophiles. It is stable under normal conditions but should be stored in a cool, dry place away from direct sunlight.

About

English Name 3'-{[(2-Cyclopentyl-6,7-dimethyl-1-oxo-2,3-dihydro-1H-inden-5-yl)oxy]methyl}-4-biphenylcarboxylic acid
Molecular Formula C30H30O4
Molecular Weight 454.57 g/mol
SMILES Cc1c2C(=O)C(Cc2cc(OCc3cccc(c3)c4ccc(cc4)C(=O)O)c1C)C5CCCC5
InChIKey KMKBEESNZAPKMP-UHFFFAOYSA-N
Last Updated: 2026-01-02 00:31

Related Q&A

Compound Q&A

How is 3'-{[(2-Cyclopentyl-6,7-dimethyl-1-oxo-2,3-dihydro-1H-inden-5-yl)oxy]methyl}-4-biphenylcarboxylic acid (CAS: 866823-73-6) typically synthesized?

The compound is typically synthesized via a multi-step process involving coupling reactions, alkylat...

Compound Q&A

What industries use 3'-{[(2-Cyclopentyl-6,7-dimethyl-1-oxo-2,3-dihydro-1H-inden-5-yl)oxy]methyl}-4-biphenylcarboxylic acid (CAS: 866823-73-6)?

This compound finds applications in the pharmaceutical industry for its potential use as a precursor...

Compound Q&A

What precautions should be taken when handling 3'-{[(2-Cyclopentyl-6,7-dimethyl-1-oxo-2,3-dihydro-1H-inden-5-yl)oxy]methyl}-4-biphenylcarboxylic acid (CAS: 866823-73-6)?

Proper personal protective equipment (PPE) should be used, including gloves, goggles, and a lab coat...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...