Compound Q&A

What precautions should be taken when handling 1,3-Dimethyl-3-phenyl-2,5-pyrrolidinedione (CAS: 77-41-8)?

Answer

1,3-Dimethyl-3-phenyl-2,5-pyrrolidinedione
When handling 1,3-Dimethyl-3-phenyl-2,5-pyrrolidinedione (CAS: 77-41-8), it is essential to use appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat. The compound should be stored in a cool, dry place, away from direct sunlight and sources of ignition. In case of a spill, it should be cleaned up using appropriate absorbent materials and the area should be well-ventilated. Always refer to the safety data sheet (SDS) for detailed handling and disposal instructions.

About

CAS No 77-41-8
English Name 1,3-Dimethyl-3-phenyl-2,5-pyrrolidinedione
Molecular Formula C12H13NO2
Molecular Weight 203.24 g/mol
SMILES CC1(CC(=O)N(C1=O)C)C2=CC=CC=C2
InChIKey AJXPJJZHWIXJCJ-UHFFFAOYSA-N
Last Updated: 2026-01-02 00:31

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1,3-Dimethyl-3-phenyl-2,5-pyrrolidinedione (CAS: 77-41-8)?

1,3-Dimethyl-3-phenyl-2,5-pyrrolidinedione (CAS: 77-41-8) is a crystalline solid with a molecular we...

Compound Q&A

How is 1,3-Dimethyl-3-phenyl-2,5-pyrrolidinedione (CAS: 77-41-8) typically synthesized?

1,3-Dimethyl-3-phenyl-2,5-pyrrolidinedione (CAS: 77-41-8) is typically synthesized through a condens...

Compound Q&A

What industries use 1,3-Dimethyl-3-phenyl-2,5-pyrrolidinedione (CAS: 77-41-8)?

1,3-Dimethyl-3-phenyl-2,5-pyrrolidinedione (CAS: 77-41-8) is primarily used in the pharmaceutical an...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...