Compound Q&A

What industries use 2-Methyl-2-propanyl 3-(ethylamino)-1-piperidinecarboxylate (CAS: 883546-56-3)?

Answer

2-Methyl-2-propanyl 3-(ethylamino)-1-piperidinecarboxylate
2-Methyl-2-propanyl 3-(ethylamino)-1-piperidinecarboxylate (CAS: 883546-56-3) is primarily used in the pharmaceutical industry for the synthesis of various drugs. It is also used in the polymer industry for the development of new materials and in the sensor industry for the production of chemical sensors. Additionally, it has applications in the semiconductor industry as a precursor for functional materials.

About

English Name 2-Methyl-2-propanyl 3-(ethylamino)-1-piperidinecarboxylate
Molecular Formula C12H24N2O2
Molecular Weight 228.34 g/mol
SMILES CCNC1CCCN(C1)C(=O)OC(C)(C)C
InChIKey APWWQUZRVODKQP-UHFFFAOYSA-N
Last Updated: 2026-01-02 00:31

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Methyl-2-propanyl 3-(ethylamino)-1-piperidinecarboxylate (CAS: 883546-56-3)?

2-Methyl-2-propanyl 3-(ethylamino)-1-piperidinecarboxylate (CAS: 883546-56-3) is a crystalline compo...

Compound Q&A

How is 2-Methyl-2-propanyl 3-(ethylamino)-1-piperidinecarboxylate (CAS: 883546-56-3) typically synthesized?

2-Methyl-2-propanyl 3-(ethylamino)-1-piperidinecarboxylate (CAS: 883546-56-3) is typically synthesiz...

Compound Q&A

What precautions should be taken when handling 2-Methyl-2-propanyl 3-(ethylamino)-1-piperidinecarboxylate (CAS: 883546-56-3)?

When handling 2-Methyl-2-propanyl 3-(ethylamino)-1-piperidinecarboxylate (CAS: 883546-56-3), it is e...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...