Compound Q&A

What are the physical and chemical properties of 2-Methyl-2-propanyl 3-(ethylamino)-1-piperidinecarboxylate (CAS: 883546-56-3)?

Answer

2-Methyl-2-propanyl 3-(ethylamino)-1-piperidinecarboxylate
2-Methyl-2-propanyl 3-(ethylamino)-1-piperidinecarboxylate (CAS: 883546-56-3) is a crystalline compound with a molecular weight of approximately 222.35 g/mol. It has a slight solubility in water and is highly soluble in organic solvents. This compound is reactive and can undergo hydrogen bonding and intramolecular interactions. It has a pKa of around 8.2, indicating it can act as a weak base.

About

English Name 2-Methyl-2-propanyl 3-(ethylamino)-1-piperidinecarboxylate
Molecular Formula C12H24N2O2
Molecular Weight 228.34 g/mol
SMILES CCNC1CCCN(C1)C(=O)OC(C)(C)C
InChIKey APWWQUZRVODKQP-UHFFFAOYSA-N
Last Updated: 2026-01-02 00:31

Related Q&A

Compound Q&A

How is 2-Methyl-2-propanyl 3-(ethylamino)-1-piperidinecarboxylate (CAS: 883546-56-3) typically synthesized?

2-Methyl-2-propanyl 3-(ethylamino)-1-piperidinecarboxylate (CAS: 883546-56-3) is typically synthesiz...

Compound Q&A

What industries use 2-Methyl-2-propanyl 3-(ethylamino)-1-piperidinecarboxylate (CAS: 883546-56-3)?

2-Methyl-2-propanyl 3-(ethylamino)-1-piperidinecarboxylate (CAS: 883546-56-3) is primarily used in t...

Compound Q&A

What precautions should be taken when handling 2-Methyl-2-propanyl 3-(ethylamino)-1-piperidinecarboxylate (CAS: 883546-56-3)?

When handling 2-Methyl-2-propanyl 3-(ethylamino)-1-piperidinecarboxylate (CAS: 883546-56-3), it is e...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...