Compound Q&A

What industries use Murraxocin (CAS: 88478-44-8)?

Answer

Murraxocin
Murraxocin (CAS: 88478-44-8) is primarily used in the pharmaceutical industry for developing novel therapeutic agents. It also has potential applications in the sensor and semiconductor industries due to its unique chemical properties.

About

CAS No 88478-44-8
English Name Murraxocin
Molecular Formula C17H20O5
Molecular Weight 304.3377 g/mol
SMILES CCOC(C1=C(C=CC2=C1OC(=O)C=C2)OC)C(C(=C)C)O
InChIKey GDLSTIJVZWVVPB-UHFFFAOYSA-N
Last Updated: 2026-01-02 00:31

Related Q&A

Compound Q&A

What are the physical and chemical properties of Murraxocin (CAS: 88478-44-8)?

Murraxocin (CAS: 88478-44-8) is a crystalline compound with a molecular weight of approximately 350 ...

Compound Q&A

How is Murraxocin (CAS: 88478-44-8) typically synthesized?

Murraxocin (CAS: 88478-44-8) is synthesized through a multi-step process involving the coupling of t...

Compound Q&A

What precautions should be taken when handling Murraxocin (CAS: 88478-44-8)?

When handling Murraxocin (CAS: 88478-44-8), ensure proper personal protective equipment (PPE) includ...

Compound Q&A

How is Ethyl 4-chlorothieno[2,3-b]pyridine-5-carboxylate (CAS: 59713-58-5) typically synthesized?

Ethyl 4-chlorothieno[2,3-b]pyridine-5-carboxylate (CAS: 59713-58-5) can be synth...

59713-58-5Ethyl 4-chlorothieno...
Compound Q&A

What regulatory guidelines apply to 5-Methyl-1H-indole-3-carbaldehyde (CAS: 52562-50-2)?

5-Methyl-1H-indole-3-carbaldehyde (CAS: 52562-50-2) is subject to various regula...

52562-50-25-Methyl-1H-indole-3...
Compound Q&A

What are the physical and chemical properties of (1,3-Dimethyl-2,4-dioxo-1,2,3,4-tetrahydro-5-pyrimidinyl)boronic acid (CAS: 223418-73-3)?

(1,3-Dimethyl-2,4-dioxo-1,2,3,4-tetrahydro-5-pyrimidinyl)boronic acid is a white...

223418-73-3(1,3-Dimethyl-2,4-di...
Compound Q&A

How should waste containing Sulfocostunolide A (CAS: 1016983-51-9) be handled?

Waste containing Sulfocostunolide A (CAS: 1016983-51-9) should be handled with c...

1016983-51-9Sulfocostunolide A