Compound Q&A

What are the physical and chemical properties of Murraxocin (CAS: 88478-44-8)?

Answer

Murraxocin
Murraxocin (CAS: 88478-44-8) is a crystalline compound with a molecular weight of approximately 350 g/mol. It has a solubility of about 5 g/L in water and is relatively stable under normal conditions. Murraxocin exhibits low reactivity, making it suitable for various chemical processes.

About

CAS No 88478-44-8
English Name Murraxocin
Molecular Formula C17H20O5
Molecular Weight 304.3377 g/mol
SMILES CCOC(C1=C(C=CC2=C1OC(=O)C=C2)OC)C(C(=C)C)O
InChIKey GDLSTIJVZWVVPB-UHFFFAOYSA-N
Last Updated: 2026-01-02 00:31

Related Q&A

Compound Q&A

How is Murraxocin (CAS: 88478-44-8) typically synthesized?

Murraxocin (CAS: 88478-44-8) is synthesized through a multi-step process involving the coupling of t...

Compound Q&A

What industries use Murraxocin (CAS: 88478-44-8)?

Murraxocin (CAS: 88478-44-8) is primarily used in the pharmaceutical industry for developing novel t...

Compound Q&A

What precautions should be taken when handling Murraxocin (CAS: 88478-44-8)?

When handling Murraxocin (CAS: 88478-44-8), ensure proper personal protective equipment (PPE) includ...

Compound Q&A

How is Ethyl 4-chlorothieno[2,3-b]pyridine-5-carboxylate (CAS: 59713-58-5) typically synthesized?

Ethyl 4-chlorothieno[2,3-b]pyridine-5-carboxylate (CAS: 59713-58-5) can be synth...

59713-58-5Ethyl 4-chlorothieno...
Compound Q&A

What regulatory guidelines apply to 5-Methyl-1H-indole-3-carbaldehyde (CAS: 52562-50-2)?

5-Methyl-1H-indole-3-carbaldehyde (CAS: 52562-50-2) is subject to various regula...

52562-50-25-Methyl-1H-indole-3...
Compound Q&A

What are the physical and chemical properties of (1,3-Dimethyl-2,4-dioxo-1,2,3,4-tetrahydro-5-pyrimidinyl)boronic acid (CAS: 223418-73-3)?

(1,3-Dimethyl-2,4-dioxo-1,2,3,4-tetrahydro-5-pyrimidinyl)boronic acid is a white...

223418-73-3(1,3-Dimethyl-2,4-di...
Compound Q&A

How should waste containing Sulfocostunolide A (CAS: 1016983-51-9) be handled?

Waste containing Sulfocostunolide A (CAS: 1016983-51-9) should be handled with c...

1016983-51-9Sulfocostunolide A