Compound Q&A

What industries use 12H-[1]Benzothieno[2,3-a]carbazole (CAS: 222-21-9)?

Answer

12H-[1]Benzothieno[2,3-a]carbazole
12H-[1]Benzothieno[2,3-a]carbazole (CAS: 222-21-9) is widely used in the semiconductor industry for its excellent electron transport properties. It is also applied in the polymer industry, particularly in the development of conjugated polymers for optoelectronic devices. Additionally, it finds applications in sensors due to its unique optical properties and in pharmaceuticals for its electronic structure.

About

CAS No 222-21-9
English Name 12H-[1]Benzothieno[2,3-a]carbazole
Molecular Formula C18H11NS
Molecular Weight 273.36 g/mol
SMILES N1C2=C(C=CC=C2)C2=C1C1=C(C=C2)C2=C(S1)C=CC=C2
InChIKey CILATXQQOGDBRQ-UHFFFAOYSA-N
Last Updated: 2026-01-02 00:31

Related Q&A

Compound Q&A

What are the physical and chemical properties of 12H-[1]Benzothieno[2,3-a]carbazole (CAS: 222-21-9)?

12H-[1]Benzothieno[2,3-a]carbazole (CAS: 222-21-9) is a crystalline compound with a molecular weight...

Compound Q&A

How is 12H-[1]Benzothieno[2,3-a]carbazole (CAS: 222-21-9) typically synthesized?

12H-[1]Benzothieno[2,3-a]carbazole (CAS: 222-21-9) is typically synthesized through a multi-step pro...

Compound Q&A

What precautions should be taken when handling 12H-[1]Benzothieno[2,3-a]carbazole (CAS: 222-21-9)?

When handling 12H-[1]Benzothieno[2,3-a]carbazole (CAS: 222-21-9), it is crucial to wear appropriate ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...